![thieno[3,2-b]thiophene-5-carbaldehyde (CAS: 31486-86-9) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0718802.png "thieno[3,2-b]thiophene-5-carbaldehyde chemical structure")
thieno[3,2-b]thiophene-5-carbaldehyde
Catalog No: FT-0718802
CAS No: 31486-86-9
- Chemical Name: thieno[3,2-b]thiophene-5-carbaldehyde
- Molecular Formula: C7H4OS2
- Molecular Weight: 168.2
- InChI Key: JKVPCDAKZCFJBU-UHFFFAOYSA-N
- InChI: InChI=1S/C7H4OS2/c8-4-5-3-7-6(10-5)1-2-9-7/h1-4H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Bolling_Point: | 308.5ºC at 760mmHg |
|---|---|
| CAS: | 31486-86-9 |
| MF: | C7H4OS2 |
| Density: | 1.473g/cm3 |
| Melting_Point: | N/A |
| Product_Name: | thieno[3,2-b]thiophene-5-carbaldehyde |
| Flash_Point: | 140.4ºC |
| FW: | 168.23600 |
| Density: | 1.473g/cm3 |
|---|---|
| MF: | C7H4OS2 |
| LogP: | 2.77530 |
| Exact_Mass: | 167.97000 |
| Bolling_Point: | 308.5ºC at 760mmHg |
| Flash_Point: | 140.4ºC |
| FW: | 168.23600 |
| Refractive_Index: | 1.773 |
| PSA: | 73.55000 |
| HS_Code: | 2934999090 |
|---|---|
| RIDADR: | NONH for all modes of transport |
